C44H30N4O — CID 3979172
3-(10,15,20-triphenyl-21,22-dihydroporphyrin-5-yl)phenol (PubChem CID 3979172) has the molecular formula C44H30N4O and a molecular weight of 630.75 g/mol. Its IUPAC name is 3-(10,15,20-triphenyl-21,22-dihydroporphyrin-5-yl)phenol.
| Compound Name | 3-(10,15,20-triphenyl-21,22-dihydroporphyrin-5-yl)phenol |
|---|---|
| PubChem CID | 3979172 |
| Molecular Formula | C44H30N4O |
| Molecular Weight | 630.75 g/mol |
| Exact Mass | 630.24 |
| IUPAC Name | 3-(10,15,20-triphenyl-21,22-dihydroporphyrin-5-yl)phenol |
| SMILES | Oc1cccc(-c2c3ccc([nH]3)c(-c3ccccc3)c3nc(c(-c4ccccc4)c4nc(c(-c5ccccc5)c5ccc2[nH]5)C=C4)C=C3)c1 |
| InChI | InChI=1S/C44H30N4O/c49-32-18-10-17-31(27-32)44-39-25-23-37(47-39)42(29-13-6-2-7-14-29)35-21-19-33(45-35)41(28-11-4-1-5-12-28)34-20-22-36(46-34)43(30-15-8-3-9-16-30)38-24-26-40(44)48-38/h1-27,47-49H/b41-33-,41-34-,42-35-,42-37-,43-36-,43-38-,44-39-,44-40- |
| InChIKey | NNVOPSDLYXLWDU-LWQDQPMZSA-N |
| XLogP | 11.03 |
| TPSA | 77.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.75 |
| LogP ≤ 5 | 11.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |