C51H34N4O5 — CID 136716533
[3-[10,15,20-tris(3-hydroxyphenyl)-21,23-dihydroporphyrin-5-yl]phenyl] benzoate (PubChem CID 136716533) has the molecular formula C51H34N4O5 and a molecular weight of 782.86 g/mol. Its IUPAC name is [3-[10,15,20-tris(3-hydroxyphenyl)-21,23-dihydroporphyrin-5-yl]phenyl] benzoate.
| Compound Name | [3-[10,15,20-tris(3-hydroxyphenyl)-21,23-dihydroporphyrin-5-yl]phenyl] benzoate |
|---|---|
| PubChem CID | 136716533 |
| Molecular Formula | C51H34N4O5 |
| Molecular Weight | 782.86 g/mol |
| Exact Mass | 782.25 |
| IUPAC Name | [3-[10,15,20-tris(3-hydroxyphenyl)-21,23-dihydroporphyrin-5-yl]phenyl] benzoate |
| SMILES | O=C(Oc1cccc(-c2c3nc(c(-c4cccc(O)c4)c4ccc([nH]4)c(-c4cccc(O)c4)c4nc(c(-c5cccc(O)c5)c5ccc2[nH]5)C=C4)C=C3)c1)c1ccccc1 |
| InChI | InChI=1S/C51H34N4O5/c56-35-14-4-10-31(26-35)47-39-18-20-41(52-39)48(32-11-5-15-36(57)27-32)43-22-24-45(54-43)50(34-13-7-17-38(29-34)60-51(59)30-8-2-1-3-9-30)46-25-23-44(55-46)49(42-21-19-40(47)53-42)33-12-6-16-37(58)28-33/h1-29,52,55-58H/b47-39-,47-40-,48-41-,48-43-,49-42-,49-44-,50-45-,50-46- |
| InChIKey | RJWKUJLEZDJJDO-VZQFQVGISA-N |
| XLogP | 11.66 |
| TPSA | 144.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.86 |
| LogP ≤ 5 | 11.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|