C87H61N7O2 — CID 101439024
[4-[10,15,20-tris[4-(N-phenylanilino)phenyl]-21,23-dihydroporphyrin-5-yl]phenyl] benzoate (PubChem CID 101439024) has the molecular formula C87H61N7O2 and a molecular weight of 1236.49 g/mol. Its IUPAC name is [4-[10,15,20-tris[4-(N-phenylanilino)phenyl]-21,23-dihydroporphyrin-5-yl]phenyl] benzoate.
| Compound Name | [4-[10,15,20-tris[4-(N-phenylanilino)phenyl]-21,23-dihydroporphyrin-5-yl]phenyl] benzoate |
|---|---|
| PubChem CID | 101439024 |
| Molecular Formula | C87H61N7O2 |
| Molecular Weight | 1236.49 g/mol |
| Exact Mass | 1235.49 |
| IUPAC Name | [4-[10,15,20-tris[4-(N-phenylanilino)phenyl]-21,23-dihydroporphyrin-5-yl]phenyl] benzoate |
| SMILES | O=C(Oc1ccc(-c2c3nc(c(-c4ccc(N(c5ccccc5)c5ccccc5)cc4)c4ccc([nH]4)c(-c4ccc(N(c5ccccc5)c5ccccc5)cc4)c4nc(c(-c5ccc(N(c6ccccc6)c6ccccc6)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1)c1ccccc1 |
| InChI | InChI=1S/C87H61N7O2/c95-87(64-22-8-1-9-23-64)96-74-50-42-63(43-51-74)86-81-58-56-79(90-81)84(61-38-46-72(47-39-61)93(67-28-14-4-15-29-67)68-30-16-5-17-31-68)77-54-52-75(88-77)83(60-36-44-71(45-37-60)92(65-24-10-2-11-25-65)66-26-12-3-13-27-66)76-53-55-78(89-76)85(80-57-59-82(86)91-80)62-40-48-73(49-41-62)94(69-32-18-6-19-33-69)70-34-20-7-21-35-70/h1-59,88,91H/b83-75-,83-76-,84-77-,84-79-,85-78-,85-80-,86-81-,86-82- |
| InChIKey | BYTSJXSWXWULBT-PPPXYBJRSA-N |
| XLogP | 22.95 |
| TPSA | 93.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 96 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1236.49 |
| LogP ≤ 5 | 22.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|