C45H31N5O2 — CID 136677887
3-[15-[4-(N-phenylanilino)phenyl]-21,23-dihydroporphyrin-5-yl]benzoic acid (PubChem CID 136677887) has the molecular formula C45H31N5O2 and a molecular weight of 673.78 g/mol. Its IUPAC name is 3-[15-[4-(N-phenylanilino)phenyl]-21,23-dihydroporphyrin-5-yl]benzoic acid.
| Compound Name | 3-[15-[4-(N-phenylanilino)phenyl]-21,23-dihydroporphyrin-5-yl]benzoic acid |
|---|---|
| PubChem CID | 136677887 |
| Molecular Formula | C45H31N5O2 |
| Molecular Weight | 673.78 g/mol |
| Exact Mass | 673.25 |
| IUPAC Name | 3-[15-[4-(N-phenylanilino)phenyl]-21,23-dihydroporphyrin-5-yl]benzoic acid |
| SMILES | O=C(O)c1cccc(-c2c3nc(cc4ccc([nH]4)c(-c4ccc(N(c5ccccc5)c5ccccc5)cc4)c4nc(cc5ccc2[nH]5)C=C4)C=C3)c1 |
| InChI | InChI=1S/C45H31N5O2/c51-45(52)31-9-7-8-30(26-31)44-41-24-18-34(48-41)27-32-16-22-39(46-32)43(40-23-17-33(47-40)28-35-19-25-42(44)49-35)29-14-20-38(21-15-29)50(36-10-3-1-4-11-36)37-12-5-2-6-13-37/h1-28,46,49H,(H,51,52)/b32-27-,33-28-,34-27-,35-28-,43-39-,43-40-,44-41-,44-42- |
| InChIKey | SLRJEEPTYNTJMZ-FIXUNOSISA-N |
| XLogP | 11.16 |
| TPSA | 97.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.78 |
| LogP ≤ 5 | 11.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |