C43H34N4O4 — CID 137274662
ethyl 3-[10,20-bis(2-methoxyphenyl)-21,23-dihydroporphyrin-5-yl]benzoate (PubChem CID 137274662) has the molecular formula C43H34N4O4 and a molecular weight of 670.77 g/mol. Its IUPAC name is ethyl 3-[10,20-bis(2-methoxyphenyl)-21,23-dihydroporphyrin-5-yl]benzoate.
| Compound Name | ethyl 3-[10,20-bis(2-methoxyphenyl)-21,23-dihydroporphyrin-5-yl]benzoate |
|---|---|
| PubChem CID | 137274662 |
| Molecular Formula | C43H34N4O4 |
| Molecular Weight | 670.77 g/mol |
| Exact Mass | 670.26 |
| IUPAC Name | ethyl 3-[10,20-bis(2-methoxyphenyl)-21,23-dihydroporphyrin-5-yl]benzoate |
| SMILES | CCOC(=O)c1cccc(-c2c3nc(c(-c4ccccc4OC)c4ccc(cc5nc(c(-c6ccccc6OC)c6ccc2[nH]6)C=C5)[nH]4)C=C3)c1 |
| InChI | InChI=1S/C43H34N4O4/c1-4-51-43(48)27-11-9-10-26(24-27)40-32-20-22-36(46-32)41(30-12-5-7-14-38(30)49-2)34-18-16-28(44-34)25-29-17-19-35(45-29)42(37-23-21-33(40)47-37)31-13-6-8-15-39(31)50-3/h5-25,44,47H,4H2,1-3H3/b28-25-,29-25-,40-32-,40-33-,41-34-,41-36-,42-35-,42-37- |
| InChIKey | YSXJFTPVHDSHAF-TUXWQCJPSA-N |
| XLogP | 9.85 |
| TPSA | 102.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.77 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |