C39H34N4O2 — CID 136868307
ethyl 2-[15-(4-tert-butylphenyl)-21,23-dihydroporphyrin-5-yl]benzoate (PubChem CID 136868307) has the molecular formula C39H34N4O2 and a molecular weight of 590.73 g/mol. Its IUPAC name is ethyl 2-[15-(4-tert-butylphenyl)-21,23-dihydroporphyrin-5-yl]benzoate.
| Compound Name | ethyl 2-[15-(4-tert-butylphenyl)-21,23-dihydroporphyrin-5-yl]benzoate |
|---|---|
| PubChem CID | 136868307 |
| Molecular Formula | C39H34N4O2 |
| Molecular Weight | 590.73 g/mol |
| Exact Mass | 590.27 |
| IUPAC Name | ethyl 2-[15-(4-tert-butylphenyl)-21,23-dihydroporphyrin-5-yl]benzoate |
| SMILES | CCOC(=O)c1ccccc1-c1c2nc(cc3ccc([nH]3)c(-c3ccc(C(C)(C)C)cc3)c3nc(cc4ccc1[nH]4)C=C3)C=C2 |
| InChI | InChI=1S/C39H34N4O2/c1-5-45-38(44)31-9-7-6-8-30(31)37-34-20-16-28(42-34)22-26-14-18-32(40-26)36(24-10-12-25(13-11-24)39(2,3)4)33-19-15-27(41-33)23-29-17-21-35(37)43-29/h6-23,40,43H,5H2,1-4H3/b26-22-,27-23-,28-22-,29-23-,36-32-,36-33-,37-34-,37-35- |
| InChIKey | KTXNCKQVJVMNNZ-QMCCWYERSA-N |
| XLogP | 9.46 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.73 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |