C35H26N6O2 — CID 136901198
ethyl N-[(10,20-diphenyl-21,23-dihydroporphyrin-5-yl)imino]carbamate (PubChem CID 136901198) has the molecular formula C35H26N6O2 and a molecular weight of 562.63 g/mol. Its IUPAC name is ethyl N-[(10,20-diphenyl-21,23-dihydroporphyrin-5-yl)imino]carbamate.
| Compound Name | ethyl N-[(10,20-diphenyl-21,23-dihydroporphyrin-5-yl)imino]carbamate |
|---|---|
| PubChem CID | 136901198 |
| Molecular Formula | C35H26N6O2 |
| Molecular Weight | 562.63 g/mol |
| Exact Mass | 562.21 |
| IUPAC Name | ethyl N-[(10,20-diphenyl-21,23-dihydroporphyrin-5-yl)imino]carbamate |
| SMILES | CCOC(=O)/N=N/c1c2nc(c(-c3ccccc3)c3ccc(cc4nc(c(-c5ccccc5)c5ccc1[nH]5)C=C4)[nH]3)C=C2 |
| InChI | InChI=1S/C35H26N6O2/c1-2-43-35(42)41-40-34-30-19-17-28(38-30)32(22-9-5-3-6-10-22)26-15-13-24(36-26)21-25-14-16-27(37-25)33(23-11-7-4-8-12-23)29-18-20-31(34)39-29/h3-21,36,39H,2H2,1H3/b24-21-,25-21-,32-26-,32-28-,33-27-,33-29-,34-30+,34-31+,41-40+ |
| InChIKey | PJZJCLLTKKOPIB-FYAMNMGISA-N |
| XLogP | 9.23 |
| TPSA | 108.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.63 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|