C64H43BrN8 — CID 173159582
10-bromo-5,15-diphenyl-21,23-dihydroporphyrin;10,20-diphenyl-21,22-dihydroporphyrin (PubChem CID 173159582) has the molecular formula C64H43BrN8 and a molecular weight of 1004.01 g/mol. Its IUPAC name is 10-bromo-5,15-diphenyl-21,23-dihydroporphyrin;10,20-diphenyl-21,22-dihydroporphyrin.
| Compound Name | 10-bromo-5,15-diphenyl-21,23-dihydroporphyrin;10,20-diphenyl-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 173159582 |
| Molecular Formula | C64H43BrN8 |
| Molecular Weight | 1004.01 g/mol |
| Exact Mass | 1002.28 |
| IUPAC Name | 10-bromo-5,15-diphenyl-21,23-dihydroporphyrin;10,20-diphenyl-21,22-dihydroporphyrin |
| SMILES | Brc1c2nc(c(-c3ccccc3)c3ccc(cc4nc(c(-c5ccccc5)c5ccc1[nH]5)C=C4)[nH]3)C=C2.C1=Cc2nc1cc1nc(c(-c3ccccc3)c3ccc(cc4ccc([nH]4)c2-c2ccccc2)[nH]3)C=C1 |
| InChI | InChI=1S/C32H21BrN4.C32H22N4/c33-32-28-17-15-26(36-28)30(20-7-3-1-4-8-20)24-13-11-22(34-24)19-23-12-14-25(35-23)31(21-9-5-2-6-10-21)27-16-18-29(32)37-27;1-3-7-21(8-4-1)31-27-15-11-23(33-27)19-25-13-17-29(35-25)32(22-9-5-2-6-10-22)30-18-14-26(36-30)20-24-12-16-28(31)34-24/h1-19,34,37H;1-20,33,35H/b22-19-,23-19-,30-24-,30-26-,31-25-,31-27-,32-28+,32-29+;23-19-,24-20-,25-19-,26-20-,31-27-,31-28-,32-29-,32-30- |
| InChIKey | HQBPLAUFTHMFKU-FGGOJEOSSA-N |
| XLogP | 16.74 |
| TPSA | 114.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1004.01 |
| LogP ≤ 5 | 16.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |