C32H24N4O2 — CID 102292008
(2S,3R)-5,15-diphenyl-2,3,22,24-tetrahydroporphyrin-2,3-diol (PubChem CID 102292008) has the molecular formula C32H24N4O2 and a molecular weight of 496.57 g/mol. Its IUPAC name is (2S,3R)-5,15-diphenyl-2,3,22,24-tetrahydroporphyrin-2,3-diol.
| Compound Name | (2S,3R)-5,15-diphenyl-2,3,22,24-tetrahydroporphyrin-2,3-diol |
|---|---|
| PubChem CID | 102292008 |
| Molecular Formula | C32H24N4O2 |
| Molecular Weight | 496.57 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | (2S,3R)-5,15-diphenyl-2,3,22,24-tetrahydroporphyrin-2,3-diol |
| SMILES | O[C@@H]1c2nc(cc3ccc([nH]3)c(-c3ccccc3)c3nc(cc4ccc([nH]4)c2-c2ccccc2)C=C3)[C@@H]1O |
| InChI | InChI=1S/C32H24N4O2/c37-31-27-18-23-13-15-25(35-23)28(19-7-3-1-4-8-19)24-14-11-21(33-24)17-22-12-16-26(34-22)29(30(36-27)32(31)38)20-9-5-2-6-10-20/h1-18,31-32,34-35,37-38H/b21-17-,22-17-,23-18-,27-18-,28-24-,28-25-,29-26-,30-29-/t31-,32+/m0/s1 |
| InChIKey | VXPKIRNRBOAYIE-KXIUAUCHSA-N |
| XLogP | 6.59 |
| TPSA | 97.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.57 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |