C33H25N3O3S — CID 71222391
2-(4-methoxyphenyl)-17-phenyl-21-thia-22,23,24-triazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1(20),2,6(24),7,9,11,13(22),14,16,18-decaene-4,5-diol (PubChem CID 71222391) has the molecular formula C33H25N3O3S and a molecular weight of 543.65 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-17-phenyl-21-thia-22,23,24-triazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1(20),2,6(24),7,9,11,13(22),14,16,18-decaene-4,5-diol.
| Compound Name | 2-(4-methoxyphenyl)-17-phenyl-21-thia-22,23,24-triazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1(20),2,6(24),7,9,11,13(22),14,16,18-decaene-4,5-diol |
|---|---|
| PubChem CID | 71222391 |
| Molecular Formula | C33H25N3O3S |
| Molecular Weight | 543.65 g/mol |
| Exact Mass | 543.16 |
| IUPAC Name | 2-(4-methoxyphenyl)-17-phenyl-21-thia-22,23,24-triazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1(20),2,6(24),7,9,11,13(22),14,16,18-decaene-4,5-diol |
| SMILES | COc1ccc(-c2c3nc(cc4ccc(cc5nc(c(-c6ccccc6)c6ccc2s6)C=C5)[nH]4)C(O)C3O)cc1 |
| InChI | InChI=1S/C33H25N3O3S/c1-39-24-12-7-20(8-13-24)30-28-16-15-27(40-28)29(19-5-3-2-4-6-19)25-14-11-22(35-25)17-21-9-10-23(34-21)18-26-32(37)33(38)31(30)36-26/h2-18,32-34,37-38H,1H3/b21-17-,22-17-,23-18-,26-18-,29-25-,29-27-,30-28-,31-30- |
| InChIKey | OPXITUROHITCER-ZHLQFNBCSA-N |
| XLogP | 7.33 |
| TPSA | 91.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.65 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |