C27H20N4O — CID 23052210
12-methoxy-13-phenyl-21,22-dihydroporphyrin (PubChem CID 23052210) has the molecular formula C27H20N4O and a molecular weight of 416.48 g/mol. Its IUPAC name is 12-methoxy-13-phenyl-21,22-dihydroporphyrin.
| Compound Name | 12-methoxy-13-phenyl-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 23052210 |
| Molecular Formula | C27H20N4O |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | 12-methoxy-13-phenyl-21,22-dihydroporphyrin |
| SMILES | COC1=C(c2ccccc2)c2cc3nc(cc4ccc(cc5ccc(cc1n2)[nH]5)[nH]4)C=C3 |
| InChI | InChI=1S/C27H20N4O/c1-32-27-25-16-23-12-10-21(30-23)14-19-8-7-18(28-19)13-20-9-11-22(29-20)15-24(31-25)26(27)17-5-3-2-4-6-17/h2-16,28,30H,1H3/b18-13-,19-14-,20-13-,21-14-,22-15-,23-16-,24-15-,25-16- |
| InChIKey | LBOBGKFUZNIPDO-BUCFDQHZSA-N |
| XLogP | 6.05 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |