C27H17N5Re — CID 174723427
3-phenyl-23,24-dihydroporphyrin-2-carbonitrile;rhenium (PubChem CID 174723427) has the molecular formula C27H17N5Re and a molecular weight of 597.68 g/mol. Its IUPAC name is 3-phenyl-23,24-dihydroporphyrin-2-carbonitrile;rhenium.
| Compound Name | 3-phenyl-23,24-dihydroporphyrin-2-carbonitrile;rhenium |
|---|---|
| PubChem CID | 174723427 |
| Molecular Formula | C27H17N5Re |
| Molecular Weight | 597.68 g/mol |
| Exact Mass | 598.10 |
| IUPAC Name | 3-phenyl-23,24-dihydroporphyrin-2-carbonitrile;rhenium |
| SMILES | N#CC1=C(c2ccccc2)c2cc3nc(cc4ccc(cc5ccc(cc1n2)[nH]5)[nH]4)C=C3.[Re] |
| InChI | InChI=1S/C27H17N5.Re/c28-16-24-25-14-22-10-8-20(30-22)12-18-6-7-19(29-18)13-21-9-11-23(31-21)15-26(32-25)27(24)17-4-2-1-3-5-17;/h1-15,29-30H;/b18-12-,19-13-,20-12-,21-13-,22-14-,23-15-,25-14-,26-15-; |
| InChIKey | YAFKSISSNUNQGK-XHTNGZILSA-N |
| XLogP | 5.97 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.68 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |