C20H14N4Zn+2 — CID 21123910
zinc 21,22-dihydroporphyrin (PubChem CID 21123910) has the molecular formula C20H14N4Zn+2 and a molecular weight of 375.75 g/mol. Its IUPAC name is zinc 21,22-dihydroporphyrin.
| Compound Name | zinc 21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 21123910 |
| Molecular Formula | C20H14N4Zn+2 |
| Molecular Weight | 375.75 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | zinc 21,22-dihydroporphyrin |
| SMILES | C1=Cc2cc3ccc(cc4ccc(cc5nc(cc1n2)C=C5)[nH]4)[nH]3.[Zn+2] |
| InChI | InChI=1S/C20H14N4.Zn/c1-2-14-10-16-5-6-18(23-16)12-20-8-7-19(24-20)11-17-4-3-15(22-17)9-13(1)21-14;/h1-12,21-22H;/q;+2/b13-9-,14-10-,15-9-,16-10-,17-11-,18-12-,19-11-,20-12-; |
| InChIKey | DYIRIWVYONKWDB-QDJBTJTOSA-N |
| XLogP | 4.65 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.75 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|