C22H18N4 — CID 158658158
21,22-dihydroporphyrin;ethene (PubChem CID 158658158) has the molecular formula C22H18N4 and a molecular weight of 338.41 g/mol. Its IUPAC name is 21,22-dihydroporphyrin;ethene.
| Compound Name | 21,22-dihydroporphyrin;ethene |
|---|---|
| PubChem CID | 158658158 |
| Molecular Formula | C22H18N4 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 21,22-dihydroporphyrin;ethene |
| SMILES | C1=Cc2cc3ccc(cc4ccc(cc5nc(cc1n2)C=C5)[nH]4)[nH]3.C=C |
| InChI | InChI=1S/C20H14N4.C2H4/c1-2-14-10-16-5-6-18(23-16)12-20-8-7-19(24-20)11-17-4-3-15(22-17)9-13(1)21-14;1-2/h1-12,21-22H;1-2H2/b13-9-,14-10-,15-9-,16-10-,17-11-,18-12-,19-11-,20-12-; |
| InChIKey | SBUXNLSOVOFDQT-QDJBTJTOSA-N |
| XLogP | 5.46 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|