C20H17N5Zn — CID 175189190
azane;21,22-dihydroporphyrin;zinc (PubChem CID 175189190) has the molecular formula C20H17N5Zn and a molecular weight of 392.78 g/mol. Its IUPAC name is azane;21,22-dihydroporphyrin;zinc.
| Compound Name | azane;21,22-dihydroporphyrin;zinc |
|---|---|
| PubChem CID | 175189190 |
| Molecular Formula | C20H17N5Zn |
| Molecular Weight | 392.78 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | azane;21,22-dihydroporphyrin;zinc |
| SMILES | C1=Cc2cc3ccc(cc4ccc(cc5nc(cc1n2)C=C5)[nH]4)[nH]3.N.[Zn] |
| InChI | InChI=1S/C20H14N4.H3N.Zn/c1-2-14-10-16-5-6-18(23-16)12-20-8-7-19(24-20)11-17-4-3-15(22-17)9-13(1)21-14;;/h1-12,21-22H;1H3;/b13-9-,14-10-,15-9-,16-10-,17-11-,18-12-,19-11-,20-12-;; |
| InChIKey | YWKKGKRBFZQMGO-IAULSPAKSA-N |
| XLogP | 4.82 |
| TPSA | 92.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.78 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|