About azane;21,22-dihydroporphyrin;iron
azane;21,22-dihydroporphyrin;iron (PubChem CID 175545548) has the molecular formula C20H17FeN5
and a molecular weight of 383.24 g/mol. Its IUPAC name is azane;21,22-dihydroporphyrin;iron.
Molecular Properties
| Compound Name | azane;21,22-dihydroporphyrin;iron |
| PubChem CID | 175545548 |
| Molecular Formula | C20H17FeN5 |
| Molecular Weight | 383.24 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | azane;21,22-dihydroporphyrin;iron |
| SMILES | C1=Cc2cc3ccc(cc4ccc(cc5nc(cc1n2)C=C5)[nH]4)[nH]3.N.[Fe] |
| InChI | InChI=1S/C20H14N4.Fe.H3N/c1-2-14-10-16-5-6-18(23-16)12-20-8-7-19(24-20)11-17-4-3-15(22-17)9-13(1)21-14;;/h1-12,21-22H;;1H3/b13-9-,14-10-,15-9-,16-10-,17-11-,18-12-,19-11-,20-12-;; |
| InChIKey | MFLJNVQTOALBGU-IAULSPAKSA-N |
| XLogP | 4.82 |
| TPSA | 92.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.24 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze azane;21,22-dihydroporphyrin;iron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;21,22-dihydroporphyrin;iron?
The IUPAC name of azane;21,22-dihydroporphyrin;iron (CID 175545548) is azane;21,22-dihydroporphyrin;iron.
What is the SMILES notation for azane;21,22-dihydroporphyrin;iron?
The canonical SMILES for azane;21,22-dihydroporphyrin;iron is C1=Cc2cc3ccc(cc4ccc(cc5nc(cc1n2)C=C5)[nH]4)[nH]3.N.[Fe].
What is the InChIKey of azane;21,22-dihydroporphyrin;iron?
The InChIKey is MFLJNVQTOALBGU-IAULSPAKSA-N. The full InChI is InChI=1S/C20H14N4.Fe.H3N/c1-2-14-10-16-5-6-18(23-16)12-20-8-7-19(24-20)11-17-4-3-15(22-17)9-13(1)21-14;;/h1-12,21-22H;;1H3/b13-9-,14-10-,15-9-,16-10-,17-11-,18-12-,19-11-,20-12-;;.
What are the key properties of azane;21,22-dihydroporphyrin;iron?
azane;21,22-dihydroporphyrin;iron has a molecular weight of 383.24 g/mol, XLogP of 4.82, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;21,22-dihydroporphyrin;iron is sourced from PubChem (CID 175545548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).