C20H14F2MnN4 — CID 71270819
difluoromanganese;21,22-dihydroporphyrin (PubChem CID 71270819) has the molecular formula C20H14F2MnN4 and a molecular weight of 403.29 g/mol. Its IUPAC name is difluoromanganese;21,22-dihydroporphyrin.
| Compound Name | difluoromanganese;21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 71270819 |
| Molecular Formula | C20H14F2MnN4 |
| Molecular Weight | 403.29 g/mol |
| Exact Mass | 403.06 |
| IUPAC Name | difluoromanganese;21,22-dihydroporphyrin |
| SMILES | C1=Cc2cc3ccc(cc4ccc(cc5nc(cc1n2)C=C5)[nH]4)[nH]3.F[Mn]F |
| InChI | InChI=1S/C20H14N4.2FH.Mn/c1-2-14-10-16-5-6-18(23-16)12-20-8-7-19(24-20)11-17-4-3-15(22-17)9-13(1)21-14;;;/h1-12,21-22H;2*1H;/q;;;+2/p-2/b13-9-,14-10-,15-9-,16-10-,17-11-,18-12-,19-11-,20-12-;;; |
| InChIKey | AEAQIDSOWWXAHI-PWUAHTGRSA-L |
| XLogP | 5.49 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.29 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |