About difluoromanganese;21,22-dihydroporphyrin
difluoromanganese;21,22-dihydroporphyrin (PubChem CID 71270819) has the molecular formula C20H14F2MnN4
and a molecular weight of 403.29 g/mol. Its IUPAC name is difluoromanganese;21,22-dihydroporphyrin.
Molecular Properties
| Compound Name | difluoromanganese;21,22-dihydroporphyrin |
| PubChem CID | 71270819 |
| Molecular Formula | C20H14F2MnN4 |
| Molecular Weight | 403.29 g/mol |
| Exact Mass | 403.06 |
| IUPAC Name | difluoromanganese;21,22-dihydroporphyrin |
| SMILES | C1=Cc2cc3ccc(cc4ccc(cc5nc(cc1n2)C=C5)[nH]4)[nH]3.F[Mn]F |
| InChI | InChI=1S/C20H14N4.2FH.Mn/c1-2-14-10-16-5-6-18(23-16)12-20-8-7-19(24-20)11-17-4-3-15(22-17)9-13(1)21-14;;;/h1-12,21-22H;2*1H;/q;;;+2/p-2/b13-9-,14-10-,15-9-,16-10-,17-11-,18-12-,19-11-,20-12-;;; |
| InChIKey | AEAQIDSOWWXAHI-PWUAHTGRSA-L |
| XLogP | 5.49 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 403.29 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze difluoromanganese;21,22-dihydroporphyrin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of difluoromanganese;21,22-dihydroporphyrin?
The IUPAC name of difluoromanganese;21,22-dihydroporphyrin (CID 71270819) is difluoromanganese;21,22-dihydroporphyrin.
What is the SMILES notation for difluoromanganese;21,22-dihydroporphyrin?
The canonical SMILES for difluoromanganese;21,22-dihydroporphyrin is C1=Cc2cc3ccc(cc4ccc(cc5nc(cc1n2)C=C5)[nH]4)[nH]3.F[Mn]F.
What is the InChIKey of difluoromanganese;21,22-dihydroporphyrin?
The InChIKey is AEAQIDSOWWXAHI-PWUAHTGRSA-L. The full InChI is InChI=1S/C20H14N4.2FH.Mn/c1-2-14-10-16-5-6-18(23-16)12-20-8-7-19(24-20)11-17-4-3-15(22-17)9-13(1)21-14;;;/h1-12,21-22H;2*1H;/q;;;+2/p-2/b13-9-,14-10-,15-9-,16-10-,17-11-,18-12-,19-11-,20-12-;;;.
What are the key properties of difluoromanganese;21,22-dihydroporphyrin?
difluoromanganese;21,22-dihydroporphyrin has a molecular weight of 403.29 g/mol, XLogP of 5.49, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for difluoromanganese;21,22-dihydroporphyrin is sourced from PubChem (CID 71270819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).