C26H20N4O — CID 162242849
21,22-dihydroporphyrin;phenol (PubChem CID 162242849) has the molecular formula C26H20N4O and a molecular weight of 404.47 g/mol. Its IUPAC name is 21,22-dihydroporphyrin;phenol.
| Compound Name | 21,22-dihydroporphyrin;phenol |
|---|---|
| PubChem CID | 162242849 |
| Molecular Formula | C26H20N4O |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | 21,22-dihydroporphyrin;phenol |
| SMILES | C1=Cc2cc3ccc(cc4ccc(cc5nc(cc1n2)C=C5)[nH]4)[nH]3.Oc1ccccc1 |
| InChI | InChI=1S/C20H14N4.C6H6O/c1-2-14-10-16-5-6-18(23-16)12-20-8-7-19(24-20)11-17-4-3-15(22-17)9-13(1)21-14;7-6-4-2-1-3-5-6/h1-12,21-22H;1-5,7H/b13-9-,14-10-,15-9-,16-10-,17-11-,18-12-,19-11-,20-12-; |
| InChIKey | QHFZTOGDGBFJRN-QDJBTJTOSA-N |
| XLogP | 6.05 |
| TPSA | 77.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |