C26H19N4OZn- — CID 172832768
21,22-dihydroporphyrin;phenol;zinc (PubChem CID 172832768) has the molecular formula C26H19N4OZn- and a molecular weight of 468.86 g/mol. Its IUPAC name is 21,22-dihydroporphyrin;phenol;zinc.
| Compound Name | 21,22-dihydroporphyrin;phenol;zinc |
|---|---|
| PubChem CID | 172832768 |
| Molecular Formula | C26H19N4OZn- |
| Molecular Weight | 468.86 g/mol |
| Exact Mass | 467.09 |
| IUPAC Name | 21,22-dihydroporphyrin;phenol;zinc |
| SMILES | C1=Cc2cc3ccc(cc4ccc(cc5nc(cc1n2)C=C5)[nH]4)[nH]3.Oc1cc[c-]cc1.[Zn] |
| InChI | InChI=1S/C20H14N4.C6H5O.Zn/c1-2-14-10-16-5-6-18(23-16)12-20-8-7-19(24-20)11-17-4-3-15(22-17)9-13(1)21-14;7-6-4-2-1-3-5-6;/h1-12,21-22H;2-5,7H;/q;-1;/b13-9-,14-10-,15-9-,16-10-,17-11-,18-12-,19-11-,20-12-;; |
| InChIKey | PTRXPMSEDOUVHK-IAULSPAKSA-N |
| XLogP | 5.85 |
| TPSA | 77.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.86 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|