About cobalt;21,22-dihydroporphyrin;4H-pyridin-4-ide
cobalt;21,22-dihydroporphyrin;4H-pyridin-4-ide (PubChem CID 175333023) has the molecular formula C25H18CoN5-
and a molecular weight of 447.39 g/mol. Its IUPAC name is cobalt;21,22-dihydroporphyrin;4H-pyridin-4-ide.
Molecular Properties
| Compound Name | cobalt;21,22-dihydroporphyrin;4H-pyridin-4-ide |
| PubChem CID | 175333023 |
| Molecular Formula | C25H18CoN5- |
| Molecular Weight | 447.39 g/mol |
| Exact Mass | 447.09 |
| IUPAC Name | cobalt;21,22-dihydroporphyrin;4H-pyridin-4-ide |
| SMILES | C1=Cc2cc3ccc(cc4ccc(cc5nc(cc1n2)C=C5)[nH]4)[nH]3.[Co].[c-]1ccncc1 |
| InChI | InChI=1S/C20H14N4.C5H4N.Co/c1-2-14-10-16-5-6-18(23-16)12-20-8-7-19(24-20)11-17-4-3-15(22-17)9-13(1)21-14;1-2-4-6-5-3-1;/h1-12,21-22H;2-5H;/q;-1;/b13-9-,14-10-,15-9-,16-10-,17-11-,18-12-,19-11-,20-12-;; |
| InChIKey | WUOKDPLXIJTXCU-IAULSPAKSA-N |
| XLogP | 5.53 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 447.39 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze cobalt;21,22-dihydroporphyrin;4H-pyridin-4-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt;21,22-dihydroporphyrin;4H-pyridin-4-ide?
The IUPAC name of cobalt;21,22-dihydroporphyrin;4H-pyridin-4-ide (CID 175333023) is cobalt;21,22-dihydroporphyrin;4H-pyridin-4-ide.
What is the SMILES notation for cobalt;21,22-dihydroporphyrin;4H-pyridin-4-ide?
The canonical SMILES for cobalt;21,22-dihydroporphyrin;4H-pyridin-4-ide is C1=Cc2cc3ccc(cc4ccc(cc5nc(cc1n2)C=C5)[nH]4)[nH]3.[Co].[c-]1ccncc1.
What is the InChIKey of cobalt;21,22-dihydroporphyrin;4H-pyridin-4-ide?
The InChIKey is WUOKDPLXIJTXCU-IAULSPAKSA-N. The full InChI is InChI=1S/C20H14N4.C5H4N.Co/c1-2-14-10-16-5-6-18(23-16)12-20-8-7-19(24-20)11-17-4-3-15(22-17)9-13(1)21-14;1-2-4-6-5-3-1;/h1-12,21-22H;2-5H;/q;-1;/b13-9-,14-10-,15-9-,16-10-,17-11-,18-12-,19-11-,20-12-;;.
What are the key properties of cobalt;21,22-dihydroporphyrin;4H-pyridin-4-ide?
cobalt;21,22-dihydroporphyrin;4H-pyridin-4-ide has a molecular weight of 447.39 g/mol, XLogP of 5.53, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt;21,22-dihydroporphyrin;4H-pyridin-4-ide is sourced from PubChem (CID 175333023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).