C23H17CoN7 — CID 175225634
cobalt;21,22-dihydroporphyrin;1,3,5-triazine (PubChem CID 175225634) has the molecular formula C23H17CoN7 and a molecular weight of 450.37 g/mol. Its IUPAC name is cobalt;21,22-dihydroporphyrin;1,3,5-triazine.
| Compound Name | cobalt;21,22-dihydroporphyrin;1,3,5-triazine |
|---|---|
| PubChem CID | 175225634 |
| Molecular Formula | C23H17CoN7 |
| Molecular Weight | 450.37 g/mol |
| Exact Mass | 450.09 |
| IUPAC Name | cobalt;21,22-dihydroporphyrin;1,3,5-triazine |
| SMILES | C1=Cc2cc3ccc(cc4ccc(cc5nc(cc1n2)C=C5)[nH]4)[nH]3.[Co].c1ncncn1 |
| InChI | InChI=1S/C20H14N4.C3H3N3.Co/c1-2-14-10-16-5-6-18(23-16)12-20-8-7-19(24-20)11-17-4-3-15(22-17)9-13(1)21-14;1-4-2-6-3-5-1;/h1-12,21-22H;1-3H;/b13-9-,14-10-,15-9-,16-10-,17-11-,18-12-,19-11-,20-12-;; |
| InChIKey | VGDWGCZQWILOMA-IAULSPAKSA-N |
| XLogP | 4.52 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.37 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |