About 21,22-dihydroporphyrin;stilbene
21,22-dihydroporphyrin;stilbene (PubChem CID 159218898) has the molecular formula C34H26N4
and a molecular weight of 490.61 g/mol. Its IUPAC name is 21,22-dihydroporphyrin;stilbene.
Molecular Properties
| Compound Name | 21,22-dihydroporphyrin;stilbene |
| PubChem CID | 159218898 |
| Molecular Formula | C34H26N4 |
| Molecular Weight | 490.61 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | 21,22-dihydroporphyrin;stilbene |
| SMILES | C(=Cc1ccccc1)c1ccccc1.C1=Cc2cc3ccc(cc4ccc(cc5nc(cc1n2)C=C5)[nH]4)[nH]3 |
| InChI | InChI=1S/C20H14N4.C14H12/c1-2-14-10-16-5-6-18(23-16)12-20-8-7-19(24-20)11-17-4-3-15(22-17)9-13(1)21-14;1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14/h1-12,21-22H;1-12H/b13-9-,14-10-,15-9-,16-10-,17-11-,18-12-,19-11-,20-12-; |
| InChIKey | QVCZMOAXPSVVQG-QDJBTJTOSA-N |
| XLogP | 8.51 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 490.61 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 21,22-dihydroporphyrin;stilbene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 21,22-dihydroporphyrin;stilbene?
The IUPAC name of 21,22-dihydroporphyrin;stilbene (CID 159218898) is 21,22-dihydroporphyrin;stilbene.
What is the SMILES notation for 21,22-dihydroporphyrin;stilbene?
The canonical SMILES for 21,22-dihydroporphyrin;stilbene is C(=Cc1ccccc1)c1ccccc1.C1=Cc2cc3ccc(cc4ccc(cc5nc(cc1n2)C=C5)[nH]4)[nH]3.
What is the InChIKey of 21,22-dihydroporphyrin;stilbene?
The InChIKey is QVCZMOAXPSVVQG-QDJBTJTOSA-N. The full InChI is InChI=1S/C20H14N4.C14H12/c1-2-14-10-16-5-6-18(23-16)12-20-8-7-19(24-20)11-17-4-3-15(22-17)9-13(1)21-14;1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14/h1-12,21-22H;1-12H/b13-9-,14-10-,15-9-,16-10-,17-11-,18-12-,19-11-,20-12-;.
What are the key properties of 21,22-dihydroporphyrin;stilbene?
21,22-dihydroporphyrin;stilbene has a molecular weight of 490.61 g/mol, XLogP of 8.51, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 21,22-dihydroporphyrin;stilbene is sourced from PubChem (CID 159218898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).