C26H18MnN4 — CID 161047080
manganese;13-phenyl-21,22-dihydroporphyrin (PubChem CID 161047080) has the molecular formula C26H18MnN4 and a molecular weight of 441.40 g/mol. Its IUPAC name is manganese;13-phenyl-21,22-dihydroporphyrin.
| Compound Name | manganese;13-phenyl-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 161047080 |
| Molecular Formula | C26H18MnN4 |
| Molecular Weight | 441.40 g/mol |
| Exact Mass | 441.09 |
| IUPAC Name | manganese;13-phenyl-21,22-dihydroporphyrin |
| SMILES | C1=Cc2cc3ccc(cc4ccc(cc5nc(cc1n2)C(c1ccccc1)=C5)[nH]4)[nH]3.[Mn] |
| InChI | InChI=1S/C26H18N4.Mn/c1-2-4-17(5-3-1)25-15-24-14-22-9-8-20(28-22)12-18-6-7-19(27-18)13-21-10-11-23(29-21)16-26(25)30-24;/h1-16,27-28H;/b18-12-,19-13-,20-12-,21-13-,22-14-,23-16-,24-14-,26-16-; |
| InChIKey | RGBUOBAZCHBLTI-WCSAAMJVSA-N |
| XLogP | 6.07 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.40 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |