C26H17ClN4V — CID 175047395
7-(4-chlorophenyl)-21,23-dihydroporphyrin;vanadium (PubChem CID 175047395) has the molecular formula C26H17ClN4V and a molecular weight of 471.85 g/mol. Its IUPAC name is 7-(4-chlorophenyl)-21,23-dihydroporphyrin;vanadium.
| Compound Name | 7-(4-chlorophenyl)-21,23-dihydroporphyrin;vanadium |
|---|---|
| PubChem CID | 175047395 |
| Molecular Formula | C26H17ClN4V |
| Molecular Weight | 471.85 g/mol |
| Exact Mass | 471.06 |
| IUPAC Name | 7-(4-chlorophenyl)-21,23-dihydroporphyrin;vanadium |
| SMILES | Clc1ccc(C2=Cc3cc4ccc(cc5nc(cc6ccc(cc2n3)[nH]6)C=C5)[nH]4)cc1.[V] |
| InChI | InChI=1S/C26H17ClN4.V/c27-17-3-1-16(2-4-17)25-14-24-13-22-8-7-20(29-22)11-18-5-6-19(28-18)12-21-9-10-23(30-21)15-26(25)31-24;/h1-15,29-30H;/b18-11-,19-12-,20-11-,21-12-,22-13-,23-15-,24-13-,26-15-; |
| InChIKey | HYHBWGPTXVBOLA-LSEBBXRNSA-N |
| XLogP | 6.72 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.85 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |