C27H20FeN4O — CID 162251253
iron;13-(4-methoxyphenyl)-21,22-dihydroporphyrin (PubChem CID 162251253) has the molecular formula C27H20FeN4O and a molecular weight of 472.33 g/mol. Its IUPAC name is iron;13-(4-methoxyphenyl)-21,22-dihydroporphyrin.
| Compound Name | iron;13-(4-methoxyphenyl)-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 162251253 |
| Molecular Formula | C27H20FeN4O |
| Molecular Weight | 472.33 g/mol |
| Exact Mass | 472.10 |
| IUPAC Name | iron;13-(4-methoxyphenyl)-21,22-dihydroporphyrin |
| SMILES | COc1ccc(C2=Cc3cc4ccc(cc5ccc(cc6nc(cc2n3)C=C6)[nH]5)[nH]4)cc1.[Fe] |
| InChI | InChI=1S/C27H20N4O.Fe/c1-32-25-10-2-17(3-11-25)26-15-24-14-22-7-6-20(29-22)12-18-4-5-19(28-18)13-21-8-9-23(30-21)16-27(26)31-24;/h2-16,28-29H,1H3;/b18-12-,19-13-,20-12-,21-13-,22-14-,23-16-,24-14-,27-16-; |
| InChIKey | WUVQBKXHNGMGOF-SDLQJEADSA-N |
| XLogP | 6.08 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.33 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|