C29H24N4O3 — CID 173083984
7-(3,4,5-trimethoxyphenyl)-21,23-dihydroporphyrin (PubChem CID 173083984) has the molecular formula C29H24N4O3 and a molecular weight of 476.54 g/mol. Its IUPAC name is 7-(3,4,5-trimethoxyphenyl)-21,23-dihydroporphyrin.
| Compound Name | 7-(3,4,5-trimethoxyphenyl)-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 173083984 |
| Molecular Formula | C29H24N4O3 |
| Molecular Weight | 476.54 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | 7-(3,4,5-trimethoxyphenyl)-21,23-dihydroporphyrin |
| SMILES | COc1cc(C2=Cc3cc4ccc(cc5nc(cc6ccc(cc2n3)[nH]6)C=C5)[nH]4)cc(OC)c1OC |
| InChI | InChI=1S/C29H24N4O3/c1-34-27-10-17(11-28(35-2)29(27)36-3)25-15-24-14-22-7-6-20(31-22)12-18-4-5-19(30-18)13-21-8-9-23(32-21)16-26(25)33-24/h4-16,31-32H,1-3H3/b18-12-,19-13-,20-12-,21-13-,22-14-,23-16-,24-14-,26-16- |
| InChIKey | SHZLHOYDFFPZSI-QACVNNBASA-N |
| XLogP | 6.10 |
| TPSA | 85.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.54 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |