C34H34N4 — CID 174990477
7-(3,5-ditert-butylphenyl)-21,23-dihydroporphyrin (PubChem CID 174990477) has the molecular formula C34H34N4 and a molecular weight of 498.67 g/mol. Its IUPAC name is 7-(3,5-ditert-butylphenyl)-21,23-dihydroporphyrin.
| Compound Name | 7-(3,5-ditert-butylphenyl)-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 174990477 |
| Molecular Formula | C34H34N4 |
| Molecular Weight | 498.67 g/mol |
| Exact Mass | 498.28 |
| IUPAC Name | 7-(3,5-ditert-butylphenyl)-21,23-dihydroporphyrin |
| SMILES | CC(C)(C)c1cc(C2=Cc3cc4ccc(cc5nc(cc6ccc(cc2n3)[nH]6)C=C5)[nH]4)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C34H34N4/c1-33(2,3)22-13-21(14-23(15-22)34(4,5)6)31-19-30-18-28-10-9-26(36-28)16-24-7-8-25(35-24)17-27-11-12-29(37-27)20-32(31)38-30/h7-20,36-37H,1-6H3/b24-16-,25-17-,26-16-,27-17-,28-18-,29-20-,30-18-,32-20- |
| InChIKey | GSGNCPIMUWNQPW-PWDOTRNNSA-N |
| XLogP | 8.67 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.67 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |