C26H18N4O12S4 — CID 173067936
5-(22,24-dihydroporphyrin-2-yl)benzene-1,2,3,4-tetrasulfonic acid (PubChem CID 173067936) has the molecular formula C26H18N4O12S4 and a molecular weight of 706.71 g/mol. Its IUPAC name is 5-(22,24-dihydroporphyrin-2-yl)benzene-1,2,3,4-tetrasulfonic acid.
| Compound Name | 5-(22,24-dihydroporphyrin-2-yl)benzene-1,2,3,4-tetrasulfonic acid |
|---|---|
| PubChem CID | 173067936 |
| Molecular Formula | C26H18N4O12S4 |
| Molecular Weight | 706.71 g/mol |
| Exact Mass | 705.98 |
| IUPAC Name | 5-(22,24-dihydroporphyrin-2-yl)benzene-1,2,3,4-tetrasulfonic acid |
| SMILES | O=S(=O)(O)c1cc(C2=Cc3cc4ccc(cc5nc(cc6ccc(cc2n3)[nH]6)C=C5)[nH]4)c(S(=O)(=O)O)c(S(=O)(=O)O)c1S(=O)(=O)O |
| InChI | InChI=1S/C26H18N4O12S4/c31-43(32,33)23-12-21(24(44(34,35)36)26(46(40,41)42)25(23)45(37,38)39)20-10-19-9-17-4-3-15(28-17)7-13-1-2-14(27-13)8-16-5-6-18(29-16)11-22(20)30-19/h1-12,28-29H,(H,31,32,33)(H,34,35,36)(H,37,38,39)(H,40,41,42)/b13-7-,14-8-,15-7-,16-8-,17-9-,18-11-,19-9-,22-11- |
| InChIKey | JMVKRZTWZIDVEK-UDEDPYRFSA-N |
| XLogP | 3.06 |
| TPSA | 274.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.71 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|