C29H22N4O2 — CID 172818761
methyl 2-[3-(22,23-dihydroporphyrin-2-yl)phenyl]acetate (PubChem CID 172818761) has the molecular formula C29H22N4O2 and a molecular weight of 458.52 g/mol. Its IUPAC name is methyl 2-[3-(22,23-dihydroporphyrin-2-yl)phenyl]acetate.
| Compound Name | methyl 2-[3-(22,23-dihydroporphyrin-2-yl)phenyl]acetate |
|---|---|
| PubChem CID | 172818761 |
| Molecular Formula | C29H22N4O2 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | methyl 2-[3-(22,23-dihydroporphyrin-2-yl)phenyl]acetate |
| SMILES | COC(=O)Cc1cccc(C2=Cc3cc4ccc(cc5ccc(cc6nc(cc2n3)C=C6)[nH]5)[nH]4)c1 |
| InChI | InChI=1S/C29H22N4O2/c1-35-29(34)12-18-3-2-4-19(11-18)27-16-26-15-24-8-7-22(31-24)13-20-5-6-21(30-20)14-23-9-10-25(32-23)17-28(27)33-26/h2-11,13-17,30-31H,12H2,1H3/b20-13-,21-14-,22-13-,23-14-,24-15-,25-17-,26-15-,28-17- |
| InChIKey | ZEBSEZNYMFONEM-PZJDANOYSA-N |
| XLogP | 5.79 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |