C28H20N4O2 — CID 141483359
methyl 3-phenyl-21,24-dihydroporphyrin-2-carboxylate (PubChem CID 141483359) has the molecular formula C28H20N4O2 and a molecular weight of 444.49 g/mol. Its IUPAC name is methyl 3-phenyl-21,24-dihydroporphyrin-2-carboxylate.
| Compound Name | methyl 3-phenyl-21,24-dihydroporphyrin-2-carboxylate |
|---|---|
| PubChem CID | 141483359 |
| Molecular Formula | C28H20N4O2 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | methyl 3-phenyl-21,24-dihydroporphyrin-2-carboxylate |
| SMILES | COC(=O)c1c(-c2ccccc2)c2cc3nc(cc4nc(cc5ccc(cc1[nH]2)[nH]5)C=C4)C=C3 |
| InChI | InChI=1S/C28H20N4O2/c1-34-28(33)27-25-16-23-12-10-21(31-23)14-19-8-7-18(29-19)13-20-9-11-22(30-20)15-24(32-25)26(27)17-5-3-2-4-6-17/h2-16,31-32H,1H3/b18-13-,19-14-,20-13-,21-14-,22-15-,23-16-,24-15-,25-16- |
| InChIKey | SCGQUTQTAQMXFB-BUCFDQHZSA-N |
| XLogP | 6.11 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |