C52H38N4O8 — CID 174837960
methyl 4-[2,3,21-tris(4-methoxycarbonylphenyl)-23H-porphyrin-5-yl]benzoate (PubChem CID 174837960) has the molecular formula C52H38N4O8 and a molecular weight of 846.90 g/mol. Its IUPAC name is methyl 4-[2,3,21-tris(4-methoxycarbonylphenyl)-23H-porphyrin-5-yl]benzoate.
| Compound Name | methyl 4-[2,3,21-tris(4-methoxycarbonylphenyl)-23H-porphyrin-5-yl]benzoate |
|---|---|
| PubChem CID | 174837960 |
| Molecular Formula | C52H38N4O8 |
| Molecular Weight | 846.90 g/mol |
| Exact Mass | 846.27 |
| IUPAC Name | methyl 4-[2,3,21-tris(4-methoxycarbonylphenyl)-23H-porphyrin-5-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2c(-c3ccc(C(=O)OC)cc3)c3c(-c4ccc(C(=O)OC)cc4)c4nc(cc5ccc(cc6nc(cc2n3-c2ccc(C(=O)OC)cc2)C=C6)[nH]5)C=C4)cc1 |
| InChI | InChI=1S/C52H38N4O8/c1-61-49(57)33-11-5-30(6-12-33)45-43-26-23-40(55-43)28-39-20-19-37(53-39)27-38-21-22-41(54-38)29-44-46(31-7-13-34(14-8-31)50(58)62-2)47(32-9-15-35(16-10-32)51(59)63-3)48(45)56(44)42-24-17-36(18-25-42)52(60)64-4/h5-29,53H,1-4H3/b37-27-,38-27-,39-28-,40-28-,41-29-,44-29-,45-43-,48-45- |
| InChIKey | XRIQZTNSUQVVAE-KDJGRSLESA-N |
| XLogP | 10.27 |
| TPSA | 151.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 846.90 |
| LogP ≤ 5 | 10.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|