C50H37BMnN4O2 — CID 174662731
manganese;phenylboronic acid;10,12,13,23-tetraphenyl-21H-porphyrin (PubChem CID 174662731) has the molecular formula C50H37BMnN4O2 and a molecular weight of 791.62 g/mol. Its IUPAC name is manganese;phenylboronic acid;10,12,13,23-tetraphenyl-21H-porphyrin.
| Compound Name | manganese;phenylboronic acid;10,12,13,23-tetraphenyl-21H-porphyrin |
|---|---|
| PubChem CID | 174662731 |
| Molecular Formula | C50H37BMnN4O2 |
| Molecular Weight | 791.62 g/mol |
| Exact Mass | 791.24 |
| IUPAC Name | manganese;phenylboronic acid;10,12,13,23-tetraphenyl-21H-porphyrin |
| SMILES | C1=Cc2cc3c(-c4ccccc4)c(-c4ccccc4)c(c(-c4ccccc4)c4nc(cc5ccc(cc1n2)[nH]5)C=C4)n3-c1ccccc1.OB(O)c1ccccc1.[Mn] |
| InChI | InChI=1S/C44H30N4.C6H7BO2.Mn/c1-5-13-30(14-6-1)41-39-26-25-36(47-39)28-35-22-21-33(45-35)27-34-23-24-37(46-34)29-40-42(31-15-7-2-8-16-31)43(32-17-9-3-10-18-32)44(41)48(40)38-19-11-4-12-20-38;8-7(9)6-4-2-1-3-5-6;/h1-29,45H;1-5,8-9H;/b33-27-,34-27-,35-28-,36-28-,37-29-,40-29-,41-39-,44-41-;; |
| InChIKey | ISPZZGZMOUPZRO-MUGWHKBPSA-N |
| XLogP | 10.48 |
| TPSA | 86.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.62 |
| LogP ≤ 5 | 10.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|