C45H30CoCrN4O — CID 175408706
chromium;cobalt;(17,18,20,24-tetraphenyl-3,22-dihydroporphyrin-2-ylidene)methanone (PubChem CID 175408706) has the molecular formula C45H30CoCrN4O and a molecular weight of 753.69 g/mol. Its IUPAC name is chromium;cobalt;(17,18,20,24-tetraphenyl-3,22-dihydroporphyrin-2-ylidene)methanone.
| Compound Name | chromium;cobalt;(17,18,20,24-tetraphenyl-3,22-dihydroporphyrin-2-ylidene)methanone |
|---|---|
| PubChem CID | 175408706 |
| Molecular Formula | C45H30CoCrN4O |
| Molecular Weight | 753.69 g/mol |
| Exact Mass | 753.12 |
| IUPAC Name | chromium;cobalt;(17,18,20,24-tetraphenyl-3,22-dihydroporphyrin-2-ylidene)methanone |
| SMILES | O=C=C1Cc2cc3ccc(cc4nc(cc5c(-c6ccccc6)c(-c6ccccc6)c(c(-c6ccccc6)c1n2)n5-c1ccccc1)C=C4)[nH]3.[Co].[Cr] |
| InChI | InChI=1S/C45H30N4O.Co.Cr/c50-29-33-25-38-27-36-22-21-34(46-36)26-35-23-24-37(47-35)28-40-41(30-13-5-1-6-14-30)42(31-15-7-2-8-16-31)45(49(40)39-19-11-4-12-20-39)43(44(33)48-38)32-17-9-3-10-18-32;;/h1-24,26-28,46H,25H2;;/b34-26-,35-26-,36-27-,37-28-,38-27-,40-28-,44-43-,45-43-;; |
| InChIKey | LUZRAWJVMJDVNK-JIHSXSDMSA-N |
| XLogP | 10.40 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.69 |
| LogP ≤ 5 | 10.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|