C50H43AlN4O — CID 174724155
alumane;3-prop-2-enoxyprop-1-ene;10,12,13,23-tetraphenyl-21H-porphyrin (PubChem CID 174724155) has the molecular formula C50H43AlN4O and a molecular weight of 742.90 g/mol. Its IUPAC name is alumane;3-prop-2-enoxyprop-1-ene;10,12,13,23-tetraphenyl-21H-porphyrin.
| Compound Name | alumane;3-prop-2-enoxyprop-1-ene;10,12,13,23-tetraphenyl-21H-porphyrin |
|---|---|
| PubChem CID | 174724155 |
| Molecular Formula | C50H43AlN4O |
| Molecular Weight | 742.90 g/mol |
| Exact Mass | 742.33 |
| IUPAC Name | alumane;3-prop-2-enoxyprop-1-ene;10,12,13,23-tetraphenyl-21H-porphyrin |
| SMILES | C1=Cc2cc3c(-c4ccccc4)c(-c4ccccc4)c(c(-c4ccccc4)c4nc(cc5ccc(cc1n2)[nH]5)C=C4)n3-c1ccccc1.C=CCOCC=C.[AlH3] |
| InChI | InChI=1S/C44H30N4.C6H10O.Al.3H/c1-5-13-30(14-6-1)41-39-26-25-36(47-39)28-35-22-21-33(45-35)27-34-23-24-37(46-34)29-40-42(31-15-7-2-8-16-31)43(32-17-9-3-10-18-32)44(41)48(40)38-19-11-4-12-20-38;1-3-5-7-6-4-2;;;;/h1-29,45H;3-4H,1-2,5-6H2;;;;/b33-27-,34-27-,35-28-,36-28-,37-29-,40-29-,41-39-,44-41-;;;;; |
| InChIKey | MFCIHQMBFCADGJ-NGLHPFRESA-N |
| XLogP | 11.31 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.90 |
| LogP ≤ 5 | 11.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|