C44H30N4O12S4 — CID 175118487
3-[2,3,21-tris(3-sulfophenyl)-23H-porphyrin-5-yl]benzenesulfonic acid (PubChem CID 175118487) has the molecular formula C44H30N4O12S4 and a molecular weight of 935.01 g/mol. Its IUPAC name is 3-[2,3,21-tris(3-sulfophenyl)-23H-porphyrin-5-yl]benzenesulfonic acid.
| Compound Name | 3-[2,3,21-tris(3-sulfophenyl)-23H-porphyrin-5-yl]benzenesulfonic acid |
|---|---|
| PubChem CID | 175118487 |
| Molecular Formula | C44H30N4O12S4 |
| Molecular Weight | 935.01 g/mol |
| Exact Mass | 934.07 |
| IUPAC Name | 3-[2,3,21-tris(3-sulfophenyl)-23H-porphyrin-5-yl]benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1cccc(-c2c(-c3cccc(S(=O)(=O)O)c3)c3c(-c4cccc(S(=O)(=O)O)c4)c4nc(cc5ccc(cc6nc(cc2n3-c2cccc(S(=O)(=O)O)c2)C=C6)[nH]5)C=C4)c1 |
| InChI | InChI=1S/C44H30N4O12S4/c49-61(50,51)35-9-1-5-26(19-35)41-39-18-17-32(47-39)23-31-14-13-29(45-31)22-30-15-16-33(46-30)24-40-42(27-6-2-10-36(20-27)62(52,53)54)43(28-7-3-11-37(21-28)63(55,56)57)44(41)48(40)34-8-4-12-38(25-34)64(58,59)60/h1-25,45H,(H,49,50,51)(H,52,53,54)(H,55,56,57)(H,58,59,60)/b29-22-,30-22-,31-23-,32-23-,33-24-,40-24-,41-39-,44-41- |
| InChIKey | SQGKFZUDCHJGHU-RJDWXLFYSA-N |
| XLogP | 8.11 |
| TPSA | 263.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 935.01 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|