C52H30FeN4 — CID 87275262
iron;10,12,13,23-tetrakis(4-ethynylphenyl)-21H-porphyrin (PubChem CID 87275262) has the molecular formula C52H30FeN4 and a molecular weight of 766.68 g/mol. Its IUPAC name is iron;10,12,13,23-tetrakis(4-ethynylphenyl)-21H-porphyrin.
| Compound Name | iron;10,12,13,23-tetrakis(4-ethynylphenyl)-21H-porphyrin |
|---|---|
| PubChem CID | 87275262 |
| Molecular Formula | C52H30FeN4 |
| Molecular Weight | 766.68 g/mol |
| Exact Mass | 766.18 |
| IUPAC Name | iron;10,12,13,23-tetrakis(4-ethynylphenyl)-21H-porphyrin |
| SMILES | C#Cc1ccc(-c2c(-c3ccc(C#C)cc3)c3c(-c4ccc(C#C)cc4)c4nc(cc5ccc(cc6nc(cc2n3-c2ccc(C#C)cc2)C=C6)[nH]5)C=C4)cc1.[Fe] |
| InChI | InChI=1S/C52H30N4.Fe/c1-5-34-9-17-38(18-10-34)49-47-30-27-44(55-47)32-43-24-23-41(53-43)31-42-25-26-45(54-42)33-48-50(39-19-11-35(6-2)12-20-39)51(40-21-13-36(7-3)14-22-40)52(49)56(48)46-28-15-37(8-4)16-29-46;/h1-4,9-33,53H;/b41-31-,42-31-,43-32-,44-32-,45-33-,48-33-,49-47-,52-49-; |
| InChIKey | RYZBBYHGBRYYJM-IZDZGFMWSA-N |
| XLogP | 11.04 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.68 |
| LogP ≤ 5 | 11.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|