C44H33InN4 — CID 173339315
indigane;10,12,13,23-tetraphenyl-21H-porphyrin (PubChem CID 173339315) has the molecular formula C44H33InN4 and a molecular weight of 732.59 g/mol. Its IUPAC name is indigane;10,12,13,23-tetraphenyl-21H-porphyrin.
| Compound Name | indigane;10,12,13,23-tetraphenyl-21H-porphyrin |
|---|---|
| PubChem CID | 173339315 |
| Molecular Formula | C44H33InN4 |
| Molecular Weight | 732.59 g/mol |
| Exact Mass | 732.17 |
| IUPAC Name | indigane;10,12,13,23-tetraphenyl-21H-porphyrin |
| SMILES | C1=Cc2cc3c(-c4ccccc4)c(-c4ccccc4)c(c(-c4ccccc4)c4nc(cc5ccc(cc1n2)[nH]5)C=C4)n3-c1ccccc1.[InH3] |
| InChI | InChI=1S/C44H30N4.In.3H/c1-5-13-30(14-6-1)41-39-26-25-36(47-39)28-35-22-21-33(45-35)27-34-23-24-37(46-34)29-40-42(31-15-7-2-8-16-31)43(32-17-9-3-10-18-32)44(41)48(40)38-19-11-4-12-20-38;;;;/h1-29,45H;;;;/b33-27-,34-27-,35-28-,36-28-,37-29-,40-29-,41-39-,44-41-;;;; |
| InChIKey | GQRBDLLEBXPRNQ-ZOZUMXJOSA-N |
| XLogP | 9.94 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.59 |
| LogP ≤ 5 | 9.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |