C68H78CuN4 — CID 87145220
copper;10,12,13,23-tetrakis(4-hexylphenyl)-21H-porphyrin (PubChem CID 87145220) has the molecular formula C68H78CuN4 and a molecular weight of 1014.95 g/mol. Its IUPAC name is copper;10,12,13,23-tetrakis(4-hexylphenyl)-21H-porphyrin.
| Compound Name | copper;10,12,13,23-tetrakis(4-hexylphenyl)-21H-porphyrin |
|---|---|
| PubChem CID | 87145220 |
| Molecular Formula | C68H78CuN4 |
| Molecular Weight | 1014.95 g/mol |
| Exact Mass | 1013.55 |
| IUPAC Name | copper;10,12,13,23-tetrakis(4-hexylphenyl)-21H-porphyrin |
| SMILES | CCCCCCc1ccc(-c2c(-c3ccc(CCCCCC)cc3)c3c(-c4ccc(CCCCCC)cc4)c4nc(cc5ccc(cc6nc(cc2n3-c2ccc(CCCCCC)cc2)C=C6)[nH]5)C=C4)cc1.[Cu] |
| InChI | InChI=1S/C68H78N4.Cu/c1-5-9-13-17-21-50-25-33-54(34-26-50)65-63-46-43-60(71-63)48-59-40-39-57(69-59)47-58-41-42-61(70-58)49-64-66(55-35-27-51(28-36-55)22-18-14-10-6-2)67(56-37-29-52(30-38-56)23-19-15-11-7-3)68(65)72(64)62-44-31-53(32-45-62)24-20-16-12-8-4;/h25-49,69H,5-24H2,1-4H3;/b57-47-,58-47-,59-48-,60-48-,61-49-,64-49-,65-63-,68-65-; |
| InChIKey | IQUVMWSMVWAPEX-BMVUDCLPSA-N |
| XLogP | 19.61 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1014.95 |
| LogP ≤ 5 | 19.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|