C44H62N4 — CID 66685161
10,12,13,23-tetrahexyl-21H-porphyrin (PubChem CID 66685161) has the molecular formula C44H62N4 and a molecular weight of 647.01 g/mol. Its IUPAC name is 10,12,13,23-tetrahexyl-21H-porphyrin.
| Compound Name | 10,12,13,23-tetrahexyl-21H-porphyrin |
|---|---|
| PubChem CID | 66685161 |
| Molecular Formula | C44H62N4 |
| Molecular Weight | 647.01 g/mol |
| Exact Mass | 646.50 |
| IUPAC Name | 10,12,13,23-tetrahexyl-21H-porphyrin |
| SMILES | CCCCCCc1c(CCCCCC)c2c(CCCCCC)c3nc(cc4ccc(cc5nc(cc1n2CCCCCC)C=C5)[nH]4)C=C3 |
| InChI | InChI=1S/C44H62N4/c1-5-9-13-17-21-39-40(22-18-14-10-6-2)44-41(23-19-15-11-7-3)42-29-28-37(47-42)32-36-25-24-34(45-36)31-35-26-27-38(46-35)33-43(39)48(44)30-20-16-12-8-4/h24-29,31-33,45H,5-23,30H2,1-4H3/b34-31-,35-31-,36-32-,37-32-,38-33-,42-41-,43-33-,44-41- |
| InChIKey | RPJXVXFBEABROD-DBKAKMDGSA-N |
| XLogP | 13.08 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.01 |
| LogP ≤ 5 | 13.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|