C21H16N4 — CID 58018116
15-methyl-21,22-dihydroporphyrin (PubChem CID 58018116) has the molecular formula C21H16N4 and a molecular weight of 324.39 g/mol. Its IUPAC name is 15-methyl-21,22-dihydroporphyrin.
| Compound Name | 15-methyl-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 58018116 |
| Molecular Formula | C21H16N4 |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 15-methyl-21,22-dihydroporphyrin |
| SMILES | Cc1c2nc(cc3ccc(cc4ccc(cc5nc1C=C5)[nH]4)[nH]3)C=C2 |
| InChI | InChI=1S/C21H16N4/c1-13-20-8-6-18(24-20)11-16-4-2-14(22-16)10-15-3-5-17(23-15)12-19-7-9-21(13)25-19/h2-12,22-23H,1H3/b14-10-,15-10-,16-11-,17-12-,18-11-,19-12-,20-13-,21-13- |
| InChIKey | ACGXAQGSMUFHOV-GFSJTGSSSA-N |
| XLogP | 4.96 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |