C22H18N4 — CID 173103171
10,20-dimethyl-21,22-dihydroporphyrin (PubChem CID 173103171) has the molecular formula C22H18N4 and a molecular weight of 338.41 g/mol. Its IUPAC name is 10,20-dimethyl-21,22-dihydroporphyrin.
| Compound Name | 10,20-dimethyl-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 173103171 |
| Molecular Formula | C22H18N4 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 10,20-dimethyl-21,22-dihydroporphyrin |
| SMILES | Cc1c2nc(cc3nc(c(C)c4ccc(cc5ccc1[nH]5)[nH]4)C=C3)C=C2 |
| InChI | InChI=1S/C22H18N4/c1-13-19-7-3-15(23-19)11-17-5-9-21(25-17)14(2)22-10-6-18(26-22)12-16-4-8-20(13)24-16/h3-12,23,25H,1-2H3/b15-11-,16-12-,17-11-,18-12-,19-13-,20-13-,21-14-,22-14- |
| InChIKey | LVGRFDWNHCUPQU-UTLFQDONSA-N |
| XLogP | 5.27 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |