C20H13N5O2 — CID 173125682
10-nitro-21,22-dihydroporphyrin (PubChem CID 173125682) has the molecular formula C20H13N5O2 and a molecular weight of 355.36 g/mol. Its IUPAC name is 10-nitro-21,22-dihydroporphyrin.
| Compound Name | 10-nitro-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 173125682 |
| Molecular Formula | C20H13N5O2 |
| Molecular Weight | 355.36 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 10-nitro-21,22-dihydroporphyrin |
| SMILES | O=[N+]([O-])c1c2nc(cc3nc(cc4ccc(cc5ccc1[nH]5)[nH]4)C=C3)C=C2 |
| InChI | InChI=1S/C20H13N5O2/c26-25(27)20-18-7-5-16(23-18)10-14-3-1-12(21-14)9-13-2-4-15(22-13)11-17-6-8-19(20)24-17/h1-11,21,23H/b12-9-,13-9-,14-10-,15-11-,16-10-,17-11-,20-18+,20-19+ |
| InChIKey | VOGUCMJQLOZZGR-DRCNEUIKSA-N |
| XLogP | 4.56 |
| TPSA | 100.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.36 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|