C26H18CoN5O2- — CID 174581534
cobalt;21,22-dihydroporphyrin;nitrobenzene (PubChem CID 174581534) has the molecular formula C26H18CoN5O2- and a molecular weight of 491.40 g/mol. Its IUPAC name is cobalt;21,22-dihydroporphyrin;nitrobenzene.
| Compound Name | cobalt;21,22-dihydroporphyrin;nitrobenzene |
|---|---|
| PubChem CID | 174581534 |
| Molecular Formula | C26H18CoN5O2- |
| Molecular Weight | 491.40 g/mol |
| Exact Mass | 491.08 |
| IUPAC Name | cobalt;21,22-dihydroporphyrin;nitrobenzene |
| SMILES | C1=Cc2cc3ccc(cc4ccc(cc5nc(cc1n2)C=C5)[nH]4)[nH]3.O=[N+]([O-])c1cc[c-]cc1.[Co] |
| InChI | InChI=1S/C20H14N4.C6H4NO2.Co/c1-2-14-10-16-5-6-18(23-16)12-20-8-7-19(24-20)11-17-4-3-15(22-17)9-13(1)21-14;8-7(9)6-4-2-1-3-5-6;/h1-12,21-22H;2-5H;/q;-1;/b13-9-,14-10-,15-9-,16-10-,17-11-,18-12-,19-11-,20-12-;; |
| InChIKey | DLJZNDVMUNEMSE-IAULSPAKSA-N |
| XLogP | 6.05 |
| TPSA | 100.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.40 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|