C20H13IN4 — CID 173057969
10-iodo-21,22-dihydroporphyrin (PubChem CID 173057969) has the molecular formula C20H13IN4 and a molecular weight of 436.26 g/mol. Its IUPAC name is 10-iodo-21,22-dihydroporphyrin.
| Compound Name | 10-iodo-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 173057969 |
| Molecular Formula | C20H13IN4 |
| Molecular Weight | 436.26 g/mol |
| Exact Mass | 436.02 |
| IUPAC Name | 10-iodo-21,22-dihydroporphyrin |
| SMILES | Ic1c2nc(cc3nc(cc4ccc(cc5ccc1[nH]5)[nH]4)C=C3)C=C2 |
| InChI | InChI=1S/C20H13IN4/c21-20-18-7-5-16(24-18)10-14-3-1-12(22-14)9-13-2-4-15(23-13)11-17-6-8-19(20)25-17/h1-11,22,24H/b12-9-,13-9-,14-10-,15-11-,16-10-,17-11-,20-18+,20-19+ |
| InChIKey | VZYRUIFHDLFEPN-DRCNEUIKSA-N |
| XLogP | 5.26 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.26 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|