C20H13FeIN4 — CID 175161972
2-iodo-21,22-dihydroporphyrin;iron (PubChem CID 175161972) has the molecular formula C20H13FeIN4 and a molecular weight of 492.10 g/mol. Its IUPAC name is 2-iodo-21,22-dihydroporphyrin;iron.
| Compound Name | 2-iodo-21,22-dihydroporphyrin;iron |
|---|---|
| PubChem CID | 175161972 |
| Molecular Formula | C20H13FeIN4 |
| Molecular Weight | 492.10 g/mol |
| Exact Mass | 491.95 |
| IUPAC Name | 2-iodo-21,22-dihydroporphyrin;iron |
| SMILES | Ic1cc2cc3ccc(cc4nc(cc5nc(cc1[nH]2)C=C5)C=C4)[nH]3.[Fe] |
| InChI | InChI=1S/C20H13IN4.Fe/c21-19-10-18-9-16-4-3-14(23-16)7-12-1-2-13(22-12)8-15-5-6-17(24-15)11-20(19)25-18;/h1-11,23,25H;/b12-7-,13-8-,14-7-,15-8-,16-9-,17-11-,18-9-,20-11-; |
| InChIKey | NCWUGKQXEUKQMQ-MDYQAFGWSA-N |
| XLogP | 5.26 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.10 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|