C20H13IN4 — CID 154422846
3-deuterio-2-iodo-21,22-dihydroporphyrin (PubChem CID 154422846) has the molecular formula C20H13IN4 and a molecular weight of 437.26 g/mol. Its IUPAC name is 3-deuterio-2-iodo-21,22-dihydroporphyrin.
| Compound Name | 3-deuterio-2-iodo-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 154422846 |
| Molecular Formula | C20H13IN4 |
| Molecular Weight | 437.26 g/mol |
| Exact Mass | 437.02 |
| IUPAC Name | 3-deuterio-2-iodo-21,22-dihydroporphyrin |
| SMILES | [2H]c1c(I)c2cc3nc(cc4nc(cc5ccc(cc1[nH]2)[nH]5)C=C4)C=C3 |
| InChI | InChI=1S/C20H13IN4/c21-19-10-18-9-16-4-3-14(23-16)7-12-1-2-13(22-12)8-15-5-6-17(24-15)11-20(19)25-18/h1-11,23,25H/b12-7-,13-8-,14-7-,15-8-,16-9-,17-11-,18-9-,20-11-/i10D |
| InChIKey | ZLPSFEIJQHJIOA-IIVSXFFASA-N |
| XLogP | 5.26 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.26 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|