C20H14N4O — CID 66692742
23,24-dihydro-21H-porphyrin-5-one (PubChem CID 66692742) has the molecular formula C20H14N4O and a molecular weight of 326.36 g/mol. Its IUPAC name is 23,24-dihydro-21H-porphyrin-5-one.
| Compound Name | 23,24-dihydro-21H-porphyrin-5-one |
|---|---|
| PubChem CID | 66692742 |
| Molecular Formula | C20H14N4O |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 23,24-dihydro-21H-porphyrin-5-one |
| SMILES | O=c1c2nc(cc3ccc(cc4ccc(cc5ccc1[nH]5)[nH]4)[nH]3)C=C2 |
| InChI | InChI=1S/C20H14N4O/c25-20-18-7-5-16(23-18)10-14-3-1-12(21-14)9-13-2-4-15(22-13)11-17-6-8-19(20)24-17/h1-11,21-23H/b12-9-,14-10-,17-11- |
| InChIKey | KZCPSWABTWQLQN-UXPYOLNKSA-N |
| XLogP | 4.06 |
| TPSA | 77.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |