About 2-(21,24-dihydroporphyrin-5-ylmethylidene)propanedioic acid
2-(21,24-dihydroporphyrin-5-ylmethylidene)propanedioic acid (PubChem CID 173483678) has the molecular formula C24H16N4O4
and a molecular weight of 424.42 g/mol. Its IUPAC name is 2-(21,24-dihydroporphyrin-5-ylmethylidene)propanedioic acid.
Molecular Properties
| Compound Name | 2-(21,24-dihydroporphyrin-5-ylmethylidene)propanedioic acid |
| PubChem CID | 173483678 |
| Molecular Formula | C24H16N4O4 |
| Molecular Weight | 424.42 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | 2-(21,24-dihydroporphyrin-5-ylmethylidene)propanedioic acid |
| SMILES | O=C(O)C(=Cc1c2nc(cc3nc(cc4ccc(cc5ccc1[nH]5)[nH]4)C=C3)C=C2)C(=O)O |
| InChI | InChI=1S/C24H16N4O4/c29-23(30)20(24(31)32)12-19-21-7-5-17(27-21)10-15-3-1-13(25-15)9-14-2-4-16(26-14)11-18-6-8-22(19)28-18/h1-12,25,27H,(H,29,30)(H,31,32)/b13-9-,14-9-,15-10-,16-11-,17-10-,18-11-,21-19-,22-19- |
| InChIKey | HTCLPQUETWXHLJ-UNVOZUGUSA-N |
| XLogP | 4.21 |
| TPSA | 131.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.42 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze 2-(21,24-dihydroporphyrin-5-ylmethylidene)propanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(21,24-dihydroporphyrin-5-ylmethylidene)propanedioic acid?
The IUPAC name of 2-(21,24-dihydroporphyrin-5-ylmethylidene)propanedioic acid (CID 173483678) is 2-(21,24-dihydroporphyrin-5-ylmethylidene)propanedioic acid.
What is the SMILES notation for 2-(21,24-dihydroporphyrin-5-ylmethylidene)propanedioic acid?
The canonical SMILES for 2-(21,24-dihydroporphyrin-5-ylmethylidene)propanedioic acid is O=C(O)C(=Cc1c2nc(cc3nc(cc4ccc(cc5ccc1[nH]5)[nH]4)C=C3)C=C2)C(=O)O.
What is the InChIKey of 2-(21,24-dihydroporphyrin-5-ylmethylidene)propanedioic acid?
The InChIKey is HTCLPQUETWXHLJ-UNVOZUGUSA-N. The full InChI is InChI=1S/C24H16N4O4/c29-23(30)20(24(31)32)12-19-21-7-5-17(27-21)10-15-3-1-13(25-15)9-14-2-4-16(26-14)11-18-6-8-22(19)28-18/h1-12,25,27H,(H,29,30)(H,31,32)/b13-9-,14-9-,15-10-,16-11-,17-10-,18-11-,21-19-,22-19-.
What are the key properties of 2-(21,24-dihydroporphyrin-5-ylmethylidene)propanedioic acid?
2-(21,24-dihydroporphyrin-5-ylmethylidene)propanedioic acid has a molecular weight of 424.42 g/mol, XLogP of 4.21, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(21,24-dihydroporphyrin-5-ylmethylidene)propanedioic acid is sourced from PubChem (CID 173483678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).