C21H16N4O2 — CID 174388961
21,22-dihydroporphyrin;formic acid (PubChem CID 174388961) has the molecular formula C21H16N4O2 and a molecular weight of 356.39 g/mol. Its IUPAC name is 21,22-dihydroporphyrin;formic acid.
| Compound Name | 21,22-dihydroporphyrin;formic acid |
|---|---|
| PubChem CID | 174388961 |
| Molecular Formula | C21H16N4O2 |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 21,22-dihydroporphyrin;formic acid |
| SMILES | C1=Cc2cc3ccc(cc4ccc(cc5nc(cc1n2)C=C5)[nH]4)[nH]3.O=CO |
| InChI | InChI=1S/C20H14N4.CH2O2/c1-2-14-10-16-5-6-18(23-16)12-20-8-7-19(24-20)11-17-4-3-15(22-17)9-13(1)21-14;2-1-3/h1-12,21-22H;1H,(H,2,3)/b13-9-,14-10-,15-9-,16-10-,17-11-,18-12-,19-11-,20-12-; |
| InChIKey | FKOZQUAPHBIQIP-QDJBTJTOSA-N |
| XLogP | 4.36 |
| TPSA | 94.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|