C22H18N6O2 — CID 174657998
21,22-dihydroporphyrin;N-formamidoformamide (PubChem CID 174657998) has the molecular formula C22H18N6O2 and a molecular weight of 398.43 g/mol. Its IUPAC name is 21,22-dihydroporphyrin;N-formamidoformamide.
| Compound Name | 21,22-dihydroporphyrin;N-formamidoformamide |
|---|---|
| PubChem CID | 174657998 |
| Molecular Formula | C22H18N6O2 |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | 21,22-dihydroporphyrin;N-formamidoformamide |
| SMILES | C1=Cc2cc3ccc(cc4ccc(cc5nc(cc1n2)C=C5)[nH]4)[nH]3.O=CNNC=O |
| InChI | InChI=1S/C20H14N4.C2H4N2O2/c1-2-14-10-16-5-6-18(23-16)12-20-8-7-19(24-20)11-17-4-3-15(22-17)9-13(1)21-14;5-1-3-4-2-6/h1-12,21-22H;1-2H,(H,3,5)(H,4,6)/b13-9-,14-10-,15-9-,16-10-,17-11-,18-12-,19-11-,20-12-; |
| InChIKey | FZPPAWGQXHMCMZ-QDJBTJTOSA-N |
| XLogP | 3.05 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|